C21H19N — CID 163491819
4-ethenyl-N,N-diphenylcyclohepta-1,4,6-trien-1-amine (PubChem CID 163491819) has the molecular formula C21H19N and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-ethenyl-N,N-diphenylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | 4-ethenyl-N,N-diphenylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 163491819 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-ethenyl-N,N-diphenylcyclohepta-1,4,6-trien-1-amine |
| SMILES | C=CC1=CC=CC(N(c2ccccc2)c2ccccc2)=CC1 |
| InChI | InChI=1S/C21H19N/c1-2-18-10-9-15-21(17-16-18)22(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h2-15,17H,1,16H2 |
| InChIKey | CNHBCGJKZUDCIA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |