C19H17NO — CID 146953475
4-(N-phenylanilino)cyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 146953475) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-(N-phenylanilino)cyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 4-(N-phenylanilino)cyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 146953475 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-(N-phenylanilino)cyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1C=CC(N(c2ccccc2)c2ccccc2)=CC1 |
| InChI | InChI=1S/C19H17NO/c21-15-16-11-13-19(14-12-16)20(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-11,13-16H,12H2 |
| InChIKey | AJEIPRZEKPBQAE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|