C22H23NO2 — CID 90738218
4-(N-(4-formylcyclohexa-1,5-dien-1-yl)-3,4-dimethylanilino)cyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 90738218) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-(N-(4-formylcyclohexa-1,5-dien-1-yl)-3,4-dimethylanilino)cyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 4-(N-(4-formylcyclohexa-1,5-dien-1-yl)-3,4-dimethylanilino)cyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 90738218 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-(N-(4-formylcyclohexa-1,5-dien-1-yl)-3,4-dimethylanilino)cyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | Cc1ccc(N(C2=CCC(C=O)C=C2)C2=CCC(C=O)C=C2)cc1C |
| InChI | InChI=1S/C22H23NO2/c1-16-3-8-22(13-17(16)2)23(20-9-4-18(14-24)5-10-20)21-11-6-19(15-25)7-12-21/h3-4,6,8-15,18-19H,5,7H2,1-2H3 |
| InChIKey | RUPCLQGIBZIYLF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|