C9H12N2O — CID 122378533
N-(3,4-dimethylphenyl)-N-methylnitrous amide (PubChem CID 122378533) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-N-methylnitrous amide.
| Compound Name | N-(3,4-dimethylphenyl)-N-methylnitrous amide |
|---|---|
| PubChem CID | 122378533 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N-(3,4-dimethylphenyl)-N-methylnitrous amide |
| SMILES | Cc1ccc(N(C)N=O)cc1C |
| InChI | InChI=1S/C9H12N2O/c1-7-4-5-9(6-8(7)2)11(3)10-12/h4-6H,1-3H3 |
| InChIKey | PEJDQKBKGWLGAK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|