About N-(3,4-dimethylphenyl)-N-methylnitrous amide
N-(3,4-dimethylphenyl)-N-methylnitrous amide (PubChem CID 122378533) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-N-methylnitrous amide.
Molecular Properties
| Compound Name | N-(3,4-dimethylphenyl)-N-methylnitrous amide |
| PubChem CID | 122378533 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N-(3,4-dimethylphenyl)-N-methylnitrous amide |
| SMILES | Cc1ccc(N(C)N=O)cc1C |
| InChI | InChI=1S/C9H12N2O/c1-7-4-5-9(6-8(7)2)11(3)10-12/h4-6H,1-3H3 |
| InChIKey | PEJDQKBKGWLGAK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dimethylphenyl)-N-methylnitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethylphenyl)-N-methylnitrous amide?
The IUPAC name of N-(3,4-dimethylphenyl)-N-methylnitrous amide (CID 122378533) is N-(3,4-dimethylphenyl)-N-methylnitrous amide.
What is the SMILES notation for N-(3,4-dimethylphenyl)-N-methylnitrous amide?
The canonical SMILES for N-(3,4-dimethylphenyl)-N-methylnitrous amide is Cc1ccc(N(C)N=O)cc1C.
What is the InChIKey of N-(3,4-dimethylphenyl)-N-methylnitrous amide?
The InChIKey is PEJDQKBKGWLGAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-7-4-5-9(6-8(7)2)11(3)10-12/h4-6H,1-3H3.
What are the key properties of N-(3,4-dimethylphenyl)-N-methylnitrous amide?
N-(3,4-dimethylphenyl)-N-methylnitrous amide has a molecular weight of 164.21 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethylphenyl)-N-methylnitrous amide is sourced from PubChem (CID 122378533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).