C13H18N4O — CID 166737206
(2Z,3Z)-3-[(3,4-dimethylphenyl)-methylhydrazinylidene]-2-hydrazinylidenebutanal (PubChem CID 166737206) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is (2Z,3Z)-3-[(3,4-dimethylphenyl)-methylhydrazinylidene]-2-hydrazinylidenebutanal.
| Compound Name | (2Z,3Z)-3-[(3,4-dimethylphenyl)-methylhydrazinylidene]-2-hydrazinylidenebutanal |
|---|---|
| PubChem CID | 166737206 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2Z,3Z)-3-[(3,4-dimethylphenyl)-methylhydrazinylidene]-2-hydrazinylidenebutanal |
| SMILES | CC(=N/N(C)c1ccc(C)c(C)c1)/C(C=O)=N/N |
| InChI | InChI=1S/C13H18N4O/c1-9-5-6-12(7-10(9)2)17(4)16-11(3)13(8-18)15-14/h5-8H,14H2,1-4H3/b15-13+,16-11- |
| InChIKey | IULLPQRXZHPHOR-YAYPWDRMSA-N |
| XLogP | 1.63 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|