C13H20N2O — CID 83535959
3-amino-N-(3,4-dimethylphenyl)-N,2-dimethylpropanamide (PubChem CID 83535959) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-amino-N-(3,4-dimethylphenyl)-N,2-dimethylpropanamide.
| Compound Name | 3-amino-N-(3,4-dimethylphenyl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 83535959 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-amino-N-(3,4-dimethylphenyl)-N,2-dimethylpropanamide |
| SMILES | Cc1ccc(N(C)C(=O)C(C)CN)cc1C |
| InChI | InChI=1S/C13H20N2O/c1-9-5-6-12(7-10(9)2)15(4)13(16)11(3)8-14/h5-7,11H,8,14H2,1-4H3 |
| InChIKey | GRLSNMJFGLLBEI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |