C12H20N2 — CID 55263892
2-N-(3,4-dimethylphenyl)-2-N-methylpropane-1,2-diamine (PubChem CID 55263892) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-N-(3,4-dimethylphenyl)-2-N-methylpropane-1,2-diamine.
| Compound Name | 2-N-(3,4-dimethylphenyl)-2-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 55263892 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-N-(3,4-dimethylphenyl)-2-N-methylpropane-1,2-diamine |
| SMILES | Cc1ccc(N(C)C(C)CN)cc1C |
| InChI | InChI=1S/C12H20N2/c1-9-5-6-12(7-10(9)2)14(4)11(3)8-13/h5-7,11H,8,13H2,1-4H3 |
| InChIKey | DMFZTYIJXMQBMW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|