C12H14O — CID 131473075
(E)-3-(3,4-dimethylphenyl)-2-methylprop-2-enal (PubChem CID 131473075) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (E)-3-(3,4-dimethylphenyl)-2-methylprop-2-enal.
| Compound Name | (E)-3-(3,4-dimethylphenyl)-2-methylprop-2-enal |
|---|---|
| PubChem CID | 131473075 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (E)-3-(3,4-dimethylphenyl)-2-methylprop-2-enal |
| SMILES | C/C(C=O)=C\c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H14O/c1-9(8-13)6-12-5-4-10(2)11(3)7-12/h4-8H,1-3H3/b9-6+ |
| InChIKey | WMHLUULKQOWFHQ-RMKNXTFCSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|