C11H12O — CID 167550254
(E)-1-deuterio-3-(3,4-dimethylphenyl)prop-2-en-1-one (PubChem CID 167550254) has the molecular formula C11H12O and a molecular weight of 161.22 g/mol. Its IUPAC name is (E)-1-deuterio-3-(3,4-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-deuterio-3-(3,4-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 167550254 |
| Molecular Formula | C11H12O |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | (E)-1-deuterio-3-(3,4-dimethylphenyl)prop-2-en-1-one |
| SMILES | [2H]C(=O)/C=C/c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C11H12O/c1-9-5-6-11(4-3-7-12)8-10(9)2/h3-8H,1-2H3/b4-3+/i7D |
| InChIKey | CHQWEULTIOCNLZ-VHXQKINZSA-N |
| XLogP | 2.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|