C12H15Br — CID 79323664
4-(3-bromo-2-methylprop-1-enyl)-1,2-dimethylbenzene (PubChem CID 79323664) has the molecular formula C12H15Br and a molecular weight of 239.16 g/mol. Its IUPAC name is 4-(3-bromo-2-methylprop-1-enyl)-1,2-dimethylbenzene.
| Compound Name | 4-(3-bromo-2-methylprop-1-enyl)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 79323664 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4-(3-bromo-2-methylprop-1-enyl)-1,2-dimethylbenzene |
| SMILES | CC(=Cc1ccc(C)c(C)c1)CBr |
| InChI | InChI=1S/C12H15Br/c1-9(8-13)6-12-5-4-10(2)11(3)7-12/h4-7H,8H2,1-3H3 |
| InChIKey | PIAODMZYOHGLHH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|