C20H22 — CID 145169100
1,2-dimethyl-4-[(1E)-2-methyl-3-(2-methylphenyl)buta-1,3-dienyl]benzene (PubChem CID 145169100) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is 1,2-dimethyl-4-[(1E)-2-methyl-3-(2-methylphenyl)buta-1,3-dienyl]benzene.
| Compound Name | 1,2-dimethyl-4-[(1E)-2-methyl-3-(2-methylphenyl)buta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 145169100 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1,2-dimethyl-4-[(1E)-2-methyl-3-(2-methylphenyl)buta-1,3-dienyl]benzene |
| SMILES | C=C(/C(C)=C/c1ccc(C)c(C)c1)c1ccccc1C |
| InChI | InChI=1S/C20H22/c1-14-10-11-19(12-16(14)3)13-17(4)18(5)20-9-7-6-8-15(20)2/h6-13H,5H2,1-4H3/b17-13+ |
| InChIKey | RLMPOSSVMOOAKL-GHRIWEEISA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|