About 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene
4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene (PubChem CID 79324340) has the molecular formula C10H9BrF2
and a molecular weight of 247.08 g/mol. Its IUPAC name is 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene.
Molecular Properties
| Compound Name | 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene |
| PubChem CID | 79324340 |
| Molecular Formula | C10H9BrF2 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene |
| SMILES | CC(=Cc1ccc(F)c(F)c1)CBr |
| InChI | InChI=1S/C10H9BrF2/c1-7(6-11)4-8-2-3-9(12)10(13)5-8/h2-5H,6H2,1H3 |
| InChIKey | YUVRQPWANJJEIG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene?
The IUPAC name of 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene (CID 79324340) is 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene.
What is the SMILES notation for 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene?
The canonical SMILES for 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene is CC(=Cc1ccc(F)c(F)c1)CBr.
What is the InChIKey of 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene?
The InChIKey is YUVRQPWANJJEIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF2/c1-7(6-11)4-8-2-3-9(12)10(13)5-8/h2-5H,6H2,1H3.
What are the key properties of 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene?
4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene has a molecular weight of 247.08 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-2-methylprop-1-enyl)-1,2-difluorobenzene is sourced from PubChem (CID 79324340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).