C10H14BrN — CID 115261662
N-(bromomethyl)-N,3,4-trimethylaniline (PubChem CID 115261662) has the molecular formula C10H14BrN and a molecular weight of 228.13 g/mol. Its IUPAC name is N-(bromomethyl)-N,3,4-trimethylaniline.
| Compound Name | N-(bromomethyl)-N,3,4-trimethylaniline |
|---|---|
| PubChem CID | 115261662 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | N-(bromomethyl)-N,3,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)CBr)cc1C |
| InChI | InChI=1S/C10H14BrN/c1-8-4-5-10(6-9(8)2)12(3)7-11/h4-6H,7H2,1-3H3 |
| InChIKey | HORXXRHOQBFCGY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|