C13H17N3O — CID 117038852
5-[(N,3,4-trimethylanilino)methyl]-1,2-oxazol-3-amine (PubChem CID 117038852) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 5-[(N,3,4-trimethylanilino)methyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[(N,3,4-trimethylanilino)methyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117038852 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 5-[(N,3,4-trimethylanilino)methyl]-1,2-oxazol-3-amine |
| SMILES | Cc1ccc(N(C)Cc2cc(N)no2)cc1C |
| InChI | InChI=1S/C13H17N3O/c1-9-4-5-11(6-10(9)2)16(3)8-12-7-13(14)15-17-12/h4-7H,8H2,1-3H3,(H2,14,15) |
| InChIKey | FNWVKFWUBXZNBO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|