C11H13N3O — CID 117038114
5-[(N-methylanilino)methyl]-1,2-oxazol-3-amine (PubChem CID 117038114) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-[(N-methylanilino)methyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[(N-methylanilino)methyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117038114 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5-[(N-methylanilino)methyl]-1,2-oxazol-3-amine |
| SMILES | CN(Cc1cc(N)no1)c1ccccc1 |
| InChI | InChI=1S/C11H13N3O/c1-14(9-5-3-2-4-6-9)8-10-7-11(12)13-15-10/h2-7H,8H2,1H3,(H2,12,13) |
| InChIKey | CVQVGZATUMLDHY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |