C12H14BrN3O — CID 117038923
5-[(5-bromo-N,2-dimethylanilino)methyl]-1,2-oxazol-3-amine (PubChem CID 117038923) has the molecular formula C12H14BrN3O and a molecular weight of 296.17 g/mol. Its IUPAC name is 5-[(5-bromo-N,2-dimethylanilino)methyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[(5-bromo-N,2-dimethylanilino)methyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117038923 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 5-[(5-bromo-N,2-dimethylanilino)methyl]-1,2-oxazol-3-amine |
| SMILES | Cc1ccc(Br)cc1N(C)Cc1cc(N)no1 |
| InChI | InChI=1S/C12H14BrN3O/c1-8-3-4-9(13)5-11(8)16(2)7-10-6-12(14)15-17-10/h3-6H,7H2,1-2H3,(H2,14,15) |
| InChIKey | MHOYYOXPWDURNW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |