C13H15BrN2O — CID 65343166
4-bromo-2-N-methyl-2-N-[(5-methylfuran-2-yl)methyl]benzene-1,2-diamine (PubChem CID 65343166) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 4-bromo-2-N-methyl-2-N-[(5-methylfuran-2-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-methyl-2-N-[(5-methylfuran-2-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 65343166 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 4-bromo-2-N-methyl-2-N-[(5-methylfuran-2-yl)methyl]benzene-1,2-diamine |
| SMILES | Cc1ccc(CN(C)c2cc(Br)ccc2N)o1 |
| InChI | InChI=1S/C13H15BrN2O/c1-9-3-5-11(17-9)8-16(2)13-7-10(14)4-6-12(13)15/h3-7H,8,15H2,1-2H3 |
| InChIKey | APHLSRIWFHZGCC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|