C13H14O4 — CID 20812373
[4-[(Z)-1-hydroxy-3-oxobut-1-enyl]cyclohexa-2,4-dien-1-yl] prop-2-enoate (PubChem CID 20812373) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is [4-[(Z)-1-hydroxy-3-oxobut-1-enyl]cyclohexa-2,4-dien-1-yl] prop-2-enoate.
| Compound Name | [4-[(Z)-1-hydroxy-3-oxobut-1-enyl]cyclohexa-2,4-dien-1-yl] prop-2-enoate |
|---|---|
| PubChem CID | 20812373 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [4-[(Z)-1-hydroxy-3-oxobut-1-enyl]cyclohexa-2,4-dien-1-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1C=CC(/C(O)=C/C(C)=O)=CC1 |
| InChI | InChI=1S/C13H14O4/c1-3-13(16)17-11-6-4-10(5-7-11)12(15)8-9(2)14/h3-6,8,11,15H,1,7H2,2H3/b12-8- |
| InChIKey | SRAJARJPCQHOEK-WQLSENKSSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|