C22H18O5 — CID 143452408
[4-(4-prop-2-enoyloxycyclohexa-1,5-dien-1-yl)phenyl] 4-hydroxybenzoate (PubChem CID 143452408) has the molecular formula C22H18O5 and a molecular weight of 362.38 g/mol. Its IUPAC name is [4-(4-prop-2-enoyloxycyclohexa-1,5-dien-1-yl)phenyl] 4-hydroxybenzoate.
| Compound Name | [4-(4-prop-2-enoyloxycyclohexa-1,5-dien-1-yl)phenyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 143452408 |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [4-(4-prop-2-enoyloxycyclohexa-1,5-dien-1-yl)phenyl] 4-hydroxybenzoate |
| SMILES | C=CC(=O)OC1C=CC(c2ccc(OC(=O)c3ccc(O)cc3)cc2)=CC1 |
| InChI | InChI=1S/C22H18O5/c1-2-21(24)26-19-11-5-15(6-12-19)16-7-13-20(14-8-16)27-22(25)17-3-9-18(23)10-4-17/h2-11,13-14,19,23H,1,12H2 |
| InChIKey | AIEZYIPSRMVTFE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|