C35H38O10 — CID 167268752
[2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)cyclohexa-1,5-diene-1-carbonyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 167268752) has the molecular formula C35H38O10 and a molecular weight of 618.68 g/mol. Its IUPAC name is [2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)cyclohexa-1,5-diene-1-carbonyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)cyclohexa-1,5-diene-1-carbonyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 167268752 |
| Molecular Formula | C35H38O10 |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | [2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)cyclohexa-1,5-diene-1-carbonyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C3=CCC(OCCCCOC(=O)C=C)C=C3)cc2C)cc1 |
| InChI | InChI=1S/C35H38O10/c1-4-32(36)42-22-8-6-20-40-28-14-10-26(11-15-28)34(38)44-30-18-19-31(25(3)24-30)45-35(39)27-12-16-29(17-13-27)41-21-7-9-23-43-33(37)5-2/h4-5,10-14,16-19,24,28H,1-2,6-9,15,20-23H2,3H3 |
| InChIKey | XJADRPZKIGQOSA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|