C48H54O12 — CID 170355638
[4-[2-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenoxy]carbonylphenyl] 4-[6-(oxan-2-yloxy)hexoxy]benzoate (PubChem CID 170355638) has the molecular formula C48H54O12 and a molecular weight of 822.95 g/mol. Its IUPAC name is [4-[2-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenoxy]carbonylphenyl] 4-[6-(oxan-2-yloxy)hexoxy]benzoate.
| Compound Name | [4-[2-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenoxy]carbonylphenyl] 4-[6-(oxan-2-yloxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 170355638 |
| Molecular Formula | C48H54O12 |
| Molecular Weight | 822.95 g/mol |
| Exact Mass | 822.36 |
| IUPAC Name | [4-[2-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenoxy]carbonylphenyl] 4-[6-(oxan-2-yloxy)hexoxy]benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OC(=O)c4ccc(OCCCCCCOC5CCCCO5)cc4)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C48H54O12/c1-3-44(49)55-31-11-6-4-9-29-53-40-23-17-37(18-24-40)47(51)59-42-27-28-43(35(2)34-42)60-48(52)38-19-25-41(26-20-38)58-46(50)36-15-21-39(22-16-36)54-30-10-5-7-12-32-56-45-14-8-13-33-57-45/h3,15-28,34,45H,1,4-14,29-33H2,2H3 |
| InChIKey | BBFODOWWJBELQO-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.95 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|