C32H36O10 — CID 145264846
[4-(cyclopenta-1,4-diene-1-carbonyloxy)-2-methylphenyl] 4-(3-propanoyloxypropoxy)benzoate;3-hydroxypropyl prop-2-enoate (PubChem CID 145264846) has the molecular formula C32H36O10 and a molecular weight of 580.63 g/mol. Its IUPAC name is [4-(cyclopenta-1,4-diene-1-carbonyloxy)-2-methylphenyl] 4-(3-propanoyloxypropoxy)benzoate;3-hydroxypropyl prop-2-enoate.
| Compound Name | [4-(cyclopenta-1,4-diene-1-carbonyloxy)-2-methylphenyl] 4-(3-propanoyloxypropoxy)benzoate;3-hydroxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 145264846 |
| Molecular Formula | C32H36O10 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | [4-(cyclopenta-1,4-diene-1-carbonyloxy)-2-methylphenyl] 4-(3-propanoyloxypropoxy)benzoate;3-hydroxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCO.CCC(=O)OCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C3=CCC=C3)cc2C)cc1 |
| InChI | InChI=1S/C26H26O7.C6H10O3/c1-3-24(27)31-16-6-15-30-21-11-9-20(10-12-21)26(29)33-23-14-13-22(17-18(23)2)32-25(28)19-7-4-5-8-19;1-2-6(8)9-5-3-4-7/h4,7-14,17H,3,5-6,15-16H2,1-2H3;2,7H,1,3-5H2 |
| InChIKey | TZRHYGLUDGTMTE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|