C15H20O5 — CID 167215946
methyl 4-(4-prop-2-enoyloxybutoxy)cyclohexa-1,5-diene-1-carboxylate (PubChem CID 167215946) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 4-(4-prop-2-enoyloxybutoxy)cyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 4-(4-prop-2-enoyloxybutoxy)cyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 167215946 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | methyl 4-(4-prop-2-enoyloxybutoxy)cyclohexa-1,5-diene-1-carboxylate |
| SMILES | C=CC(=O)OCCCCOC1C=CC(C(=O)OC)=CC1 |
| InChI | InChI=1S/C15H20O5/c1-3-14(16)20-11-5-4-10-19-13-8-6-12(7-9-13)15(17)18-2/h3,6-8,13H,1,4-5,9-11H2,2H3 |
| InChIKey | URRDKWHPNZOVGU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|