C17H10Cl2F6O2 — CID 89357307
4-[2-(4-carbonochloridoylcyclohexa-2,4-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoyl chloride (PubChem CID 89357307) has the molecular formula C17H10Cl2F6O2 and a molecular weight of 431.16 g/mol. Its IUPAC name is 4-[2-(4-carbonochloridoylcyclohexa-2,4-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoyl chloride.
| Compound Name | 4-[2-(4-carbonochloridoylcyclohexa-2,4-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoyl chloride |
|---|---|
| PubChem CID | 89357307 |
| Molecular Formula | C17H10Cl2F6O2 |
| Molecular Weight | 431.16 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 4-[2-(4-carbonochloridoylcyclohexa-2,4-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoyl chloride |
| SMILES | O=C(Cl)C1=CCC(C(c2ccc(C(=O)Cl)cc2)(C(F)(F)F)C(F)(F)F)C=C1 |
| InChI | InChI=1S/C17H10Cl2F6O2/c18-13(26)9-1-5-11(6-2-9)15(16(20,21)22,17(23,24)25)12-7-3-10(4-8-12)14(19)27/h1-7,12H,8H2 |
| InChIKey | FEKCGRVPEVACEX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.16 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|