C14H26S — CID 145365968
butane;(2E,4Z)-4-ethenyl-3-methylsulfanylhepta-2,4-diene (PubChem CID 145365968) has the molecular formula C14H26S and a molecular weight of 226.43 g/mol. Its IUPAC name is butane;(2E,4Z)-4-ethenyl-3-methylsulfanylhepta-2,4-diene.
| Compound Name | butane;(2E,4Z)-4-ethenyl-3-methylsulfanylhepta-2,4-diene |
|---|---|
| PubChem CID | 145365968 |
| Molecular Formula | C14H26S |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | butane;(2E,4Z)-4-ethenyl-3-methylsulfanylhepta-2,4-diene |
| SMILES | C=CC(=C/CC)/C(=C\C)SC.CCCC |
| InChI | InChI=1S/C10H16S.C4H10/c1-5-8-9(6-2)10(7-3)11-4;1-3-4-2/h6-8H,2,5H2,1,3-4H3;3-4H2,1-2H3/b9-8-,10-7+; |
| InChIKey | IPWWILMCLIXLTP-ZTOBHTJDSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|