C11H14O — CID 141087599
3-penta-1,3-dien-3-ylhexa-1,3-dien-1-one (PubChem CID 141087599) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 3-penta-1,3-dien-3-ylhexa-1,3-dien-1-one.
| Compound Name | 3-penta-1,3-dien-3-ylhexa-1,3-dien-1-one |
|---|---|
| PubChem CID | 141087599 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 3-penta-1,3-dien-3-ylhexa-1,3-dien-1-one |
| SMILES | C=CC(=CC)C(C=C=O)=CCC |
| InChI | InChI=1S/C11H14O/c1-4-7-11(8-9-12)10(5-2)6-3/h5-8H,2,4H2,1,3H3 |
| InChIKey | QXSUBIPWMMMVMY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|