C13H20 — CID 143353522
(1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene (PubChem CID 143353522) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene.
| Compound Name | (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene |
|---|---|
| PubChem CID | 143353522 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene |
| SMILES | C=C1/C=C\C=C/CCC(CCC)C1 |
| InChI | InChI=1S/C13H20/c1-3-8-13-10-7-5-4-6-9-12(2)11-13/h4-6,9,13H,2-3,7-8,10-11H2,1H3/b5-4-,9-6- |
| InChIKey | XVACWGLYXWUMBI-WXOLFVLTSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |