About (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene
(1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene (PubChem CID 143353522) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene.
Molecular Properties
| Compound Name | (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene |
| PubChem CID | 143353522 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene |
| SMILES | C=C1/C=C\C=C/CCC(CCC)C1 |
| InChI | InChI=1S/C13H20/c1-3-8-13-10-7-5-4-6-9-12(2)11-13/h4-6,9,13H,2-3,7-8,10-11H2,1H3/b5-4-,9-6- |
| InChIKey | XVACWGLYXWUMBI-WXOLFVLTSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene?
The IUPAC name of (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene (CID 143353522) is (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene.
What is the SMILES notation for (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene?
The canonical SMILES for (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene is C=C1/C=C\C=C/CCC(CCC)C1.
What is the InChIKey of (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene?
The InChIKey is XVACWGLYXWUMBI-WXOLFVLTSA-N. The full InChI is InChI=1S/C13H20/c1-3-8-13-10-7-5-4-6-9-12(2)11-13/h4-6,9,13H,2-3,7-8,10-11H2,1H3/b5-4-,9-6-.
What are the key properties of (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene?
(1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene has a molecular weight of 176.30 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3Z)-5-methylidene-7-propylcyclonona-1,3-diene is sourced from PubChem (CID 143353522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).