About azane;1-methylidene-4-propylcyclohexane;molecular hydrogen
azane;1-methylidene-4-propylcyclohexane;molecular hydrogen (PubChem CID 145207106) has the molecular formula C10H23N
and a molecular weight of 157.30 g/mol. Its IUPAC name is azane;1-methylidene-4-propylcyclohexane;molecular hydrogen.
Molecular Properties
| Compound Name | azane;1-methylidene-4-propylcyclohexane;molecular hydrogen |
| PubChem CID | 145207106 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | azane;1-methylidene-4-propylcyclohexane;molecular hydrogen |
| SMILES | C=C1CCC(CCC)CC1.N.[H][H] |
| InChI | InChI=1S/C10H18.H3N.H2/c1-3-4-10-7-5-9(2)6-8-10;;/h10H,2-8H2,1H3;1H3;1H |
| InChIKey | FXJSVNRBJZWMLB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;1-methylidene-4-propylcyclohexane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-methylidene-4-propylcyclohexane;molecular hydrogen?
The IUPAC name of azane;1-methylidene-4-propylcyclohexane;molecular hydrogen (CID 145207106) is azane;1-methylidene-4-propylcyclohexane;molecular hydrogen.
What is the SMILES notation for azane;1-methylidene-4-propylcyclohexane;molecular hydrogen?
The canonical SMILES for azane;1-methylidene-4-propylcyclohexane;molecular hydrogen is C=C1CCC(CCC)CC1.N.[H][H].
What is the InChIKey of azane;1-methylidene-4-propylcyclohexane;molecular hydrogen?
The InChIKey is FXJSVNRBJZWMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18.H3N.H2/c1-3-4-10-7-5-9(2)6-8-10;;/h10H,2-8H2,1H3;1H3;1H.
What are the key properties of azane;1-methylidene-4-propylcyclohexane;molecular hydrogen?
azane;1-methylidene-4-propylcyclohexane;molecular hydrogen has a molecular weight of 157.30 g/mol, XLogP of 3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-methylidene-4-propylcyclohexane;molecular hydrogen is sourced from PubChem (CID 145207106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).