C20H34N4O2 — CID 3378512
N,N'-bis[(4-propylcyclohexylidene)amino]oxamide (PubChem CID 3378512) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N,N'-bis[(4-propylcyclohexylidene)amino]oxamide.
| Compound Name | N,N'-bis[(4-propylcyclohexylidene)amino]oxamide |
|---|---|
| PubChem CID | 3378512 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | N,N'-bis[(4-propylcyclohexylidene)amino]oxamide |
| SMILES | CCCC1CCC(=NNC(=O)C(=O)NN=C2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C20H34N4O2/c1-3-5-15-7-11-17(12-8-15)21-23-19(25)20(26)24-22-18-13-9-16(6-4-2)10-14-18/h15-16H,3-14H2,1-2H3,(H,23,25)(H,24,26)/b21-17-,22-18- |
| InChIKey | MTJIIZLQBRHHFK-SVJWQLCWSA-N |
| XLogP | 3.91 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|