C12H19N3O2 — CID 129445430
N-cyclopropyl-N'-[[(3S)-3-ethylcyclopentylidene]amino]oxamide (PubChem CID 129445430) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-cyclopropyl-N'-[[(3S)-3-ethylcyclopentylidene]amino]oxamide.
| Compound Name | N-cyclopropyl-N'-[[(3S)-3-ethylcyclopentylidene]amino]oxamide |
|---|---|
| PubChem CID | 129445430 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-cyclopropyl-N'-[[(3S)-3-ethylcyclopentylidene]amino]oxamide |
| SMILES | CC[C@H]1CCC(=NNC(=O)C(=O)NC2CC2)C1 |
| InChI | InChI=1S/C12H19N3O2/c1-2-8-3-4-10(7-8)14-15-12(17)11(16)13-9-5-6-9/h8-9H,2-7H2,1H3,(H,13,16)(H,15,17)/t8-/m0/s1 |
| InChIKey | LNNXUYLNJJTXPN-QMMMGPOBSA-N |
| XLogP | 0.95 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|