C17H22N4O2S — CID 129448484
2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-N-[[(3R)-3-ethylcyclopentylidene]amino]acetamide (PubChem CID 129448484) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-N-[[(3R)-3-ethylcyclopentylidene]amino]acetamide.
| Compound Name | 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-N-[[(3R)-3-ethylcyclopentylidene]amino]acetamide |
|---|---|
| PubChem CID | 129448484 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-N-[[(3R)-3-ethylcyclopentylidene]amino]acetamide |
| SMILES | CC[C@@H]1CCC(=NNC(=O)Cc2nc3sc(C)c(C)c3c(=O)[nH]2)C1 |
| InChI | InChI=1S/C17H22N4O2S/c1-4-11-5-6-12(7-11)20-21-14(22)8-13-18-16(23)15-9(2)10(3)24-17(15)19-13/h11H,4-8H2,1-3H3,(H,21,22)(H,18,19,23)/t11-/m1/s1 |
| InChIKey | OKPQDIZFDKQUGL-LLVKDONJSA-N |
| XLogP | 2.83 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|