C18H17ClN4O4S — CID 4808802
N'-[2-(4-chlorophenoxy)acetyl]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetohydrazide (PubChem CID 4808802) has the molecular formula C18H17ClN4O4S and a molecular weight of 420.88 g/mol. Its IUPAC name is N'-[2-(4-chlorophenoxy)acetyl]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetohydrazide.
| Compound Name | N'-[2-(4-chlorophenoxy)acetyl]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 4808802 |
| Molecular Formula | C18H17ClN4O4S |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | N'-[2-(4-chlorophenoxy)acetyl]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetohydrazide |
| SMILES | Cc1sc2nc(CC(=O)NNC(=O)COc3ccc(Cl)cc3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C18H17ClN4O4S/c1-9-10(2)28-18-16(9)17(26)20-13(21-18)7-14(24)22-23-15(25)8-27-12-5-3-11(19)4-6-12/h3-6H,7-8H2,1-2H3,(H,22,24)(H,23,25)(H,20,21,26) |
| InChIKey | NJDJLERAZIACGQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|