C19H21N5O2S2 — CID 8601820
1-[[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]amino]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 8601820) has the molecular formula C19H21N5O2S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-[[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]amino]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]amino]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 8601820 |
| Molecular Formula | C19H21N5O2S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 1-[[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]amino]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NNC(=O)Cc2nc3sc(C)c(C)c3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C19H21N5O2S2/c1-9-5-6-10(2)13(7-9)20-19(27)24-23-15(25)8-14-21-17(26)16-11(3)12(4)28-18(16)22-14/h5-7H,8H2,1-4H3,(H,23,25)(H2,20,24,27)(H,21,22,26) |
| InChIKey | IWQFZEPKHOKCDR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|