C19H20N4O3S2 — CID 4808821
N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2-phenylsulfanylpropanehydrazide (PubChem CID 4808821) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2-phenylsulfanylpropanehydrazide.
| Compound Name | N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2-phenylsulfanylpropanehydrazide |
|---|---|
| PubChem CID | 4808821 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2-phenylsulfanylpropanehydrazide |
| SMILES | Cc1sc2nc(CC(=O)NNC(=O)C(C)Sc3ccccc3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C19H20N4O3S2/c1-10-11(2)28-19-16(10)18(26)20-14(21-19)9-15(24)22-23-17(25)12(3)27-13-7-5-4-6-8-13/h4-8,12H,9H2,1-3H3,(H,22,24)(H,23,25)(H,20,21,26) |
| InChIKey | AJHCKEHSWYYKAO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|