C18H19N5O2S2 — CID 8601804
1-[[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]amino]-3-(4-methylphenyl)thiourea (PubChem CID 8601804) has the molecular formula C18H19N5O2S2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 1-[[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]amino]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]amino]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8601804 |
| Molecular Formula | C18H19N5O2S2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 1-[[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]amino]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)Cc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H19N5O2S2/c1-9-4-6-12(7-5-9)19-18(26)23-22-14(24)8-13-20-16(25)15-10(2)11(3)27-17(15)21-13/h4-7H,8H2,1-3H3,(H,22,24)(H2,19,23,26)(H,20,21,25) |
| InChIKey | VDSSMORNRNSOMT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|