C19H20N4O5S — CID 4808796
N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2,3-dimethoxybenzohydrazide (PubChem CID 4808796) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2,3-dimethoxybenzohydrazide.
| Compound Name | N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2,3-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 4808796 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2,3-dimethoxybenzohydrazide |
| SMILES | COc1cccc(C(=O)NNC(=O)Cc2nc3sc(C)c(C)c3c(=O)[nH]2)c1OC |
| InChI | InChI=1S/C19H20N4O5S/c1-9-10(2)29-19-15(9)18(26)20-13(21-19)8-14(24)22-23-17(25)11-6-5-7-12(27-3)16(11)28-4/h5-7H,8H2,1-4H3,(H,22,24)(H,23,25)(H,20,21,26) |
| InChIKey | ZIYRQOGEOZGOLL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|