C17H14Cl2N4O2S — CID 9177304
N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetamide (PubChem CID 9177304) has the molecular formula C17H14Cl2N4O2S and a molecular weight of 409.30 g/mol. Its IUPAC name is N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetamide.
| Compound Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetamide |
|---|---|
| PubChem CID | 9177304 |
| Molecular Formula | C17H14Cl2N4O2S |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetamide |
| SMILES | Cc1sc2nc(CC(=O)N/N=C\c3c(Cl)cccc3Cl)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C17H14Cl2N4O2S/c1-8-9(2)26-17-15(8)16(25)21-13(22-17)6-14(24)23-20-7-10-11(18)4-3-5-12(10)19/h3-5,7H,6H2,1-2H3,(H,23,24)(H,21,22,25)/b20-7- |
| InChIKey | QFLYQBKHLIWYRW-SCDVKCJHSA-N |
| XLogP | 3.60 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|