C24H22N4O3S — CID 55352687
2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 55352687) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 55352687 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | Cc1sc2nc(CC(=O)N/N=C/c3cccc(OCc4ccccc4)c3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C24H22N4O3S/c1-15-16(2)32-24-22(15)23(30)26-20(27-24)12-21(29)28-25-13-18-9-6-10-19(11-18)31-14-17-7-4-3-5-8-17/h3-11,13H,12,14H2,1-2H3,(H,28,29)(H,26,27,30)/b25-13+ |
| InChIKey | JSBIWMWRXUPCNX-DHRITJCHSA-N |
| XLogP | 3.87 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|