C26H24N2O4S — CID 3469800
ethyl 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-3-(3-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 3469800) has the molecular formula C26H24N2O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is ethyl 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-3-(3-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | ethyl 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-3-(3-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3469800 |
| Molecular Formula | C26H24N2O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | ethyl 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-3-(3-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(=Cc1cccc(OCc2ccccc2)c1)c1nc2sc(C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C26H24N2O4S/c1-4-31-26(30)21(23-27-24(29)22-16(2)17(3)33-25(22)28-23)14-19-11-8-12-20(13-19)32-15-18-9-6-5-7-10-18/h5-14H,4,15H2,1-3H3,(H,27,28,29) |
| InChIKey | QQJODSWYVUORTN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|