C20H17F3N2O3S — CID 92964541
ethyl (E)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 92964541) has the molecular formula C20H17F3N2O3S and a molecular weight of 422.43 g/mol. Its IUPAC name is ethyl (E)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 92964541 |
| Molecular Formula | C20H17F3N2O3S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | ethyl (E)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1ccccc1C(F)(F)F)c1nc2sc(C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C20H17F3N2O3S/c1-4-28-19(27)13(9-12-7-5-6-8-14(12)20(21,22)23)16-24-17(26)15-10(2)11(3)29-18(15)25-16/h5-9H,4H2,1-3H3,(H,24,25,26)/b13-9+ |
| InChIKey | QRVYRTSYRBQVEH-UKTHLTGXSA-N |
| XLogP | 4.72 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|