C23H26N2O3S — CID 3568788
ethyl 3-(4-tert-butylphenyl)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enoate (PubChem CID 3568788) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is ethyl 3-(4-tert-butylphenyl)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enoate.
| Compound Name | ethyl 3-(4-tert-butylphenyl)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3568788 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | ethyl 3-(4-tert-butylphenyl)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)C(=Cc1ccc(C(C)(C)C)cc1)c1nc2sc(C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C23H26N2O3S/c1-7-28-22(27)17(12-15-8-10-16(11-9-15)23(4,5)6)19-24-20(26)18-13(2)14(3)29-21(18)25-19/h8-12H,7H2,1-6H3,(H,24,25,26) |
| InChIKey | RZOABQACMCMKQF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|