C17H14ClN5O4S — CID 42995693
N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetamide (PubChem CID 42995693) has the molecular formula C17H14ClN5O4S and a molecular weight of 419.85 g/mol. Its IUPAC name is N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetamide.
| Compound Name | N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetamide |
|---|---|
| PubChem CID | 42995693 |
| Molecular Formula | C17H14ClN5O4S |
| Molecular Weight | 419.85 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetamide |
| SMILES | Cc1sc2nc(CC(=O)N/N=C/c3ccc(Cl)c([N+](=O)[O-])c3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C17H14ClN5O4S/c1-8-9(2)28-17-15(8)16(25)20-13(21-17)6-14(24)22-19-7-10-3-4-11(18)12(5-10)23(26)27/h3-5,7H,6H2,1-2H3,(H,22,24)(H,20,21,25)/b19-7+ |
| InChIKey | ZQNJDDJQXZMODU-FBCYGCLPSA-N |
| XLogP | 2.86 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.85 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|