C17H15ClN4O5 — CID 3277109
N'-[(4-chloro-3-nitrophenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide (PubChem CID 3277109) has the molecular formula C17H15ClN4O5 and a molecular weight of 390.78 g/mol. Its IUPAC name is N'-[(4-chloro-3-nitrophenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide.
| Compound Name | N'-[(4-chloro-3-nitrophenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 3277109 |
| Molecular Formula | C17H15ClN4O5 |
| Molecular Weight | 390.78 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N'-[(4-chloro-3-nitrophenyl)methylideneamino]-N-(4-methoxyphenyl)propanediamide |
| SMILES | COc1ccc(NC(=O)CC(=O)NN=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H15ClN4O5/c1-27-13-5-3-12(4-6-13)20-16(23)9-17(24)21-19-10-11-2-7-14(18)15(8-11)22(25)26/h2-8,10H,9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | OPYLNJQIORBPDX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.78 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|