C18H19ClN4O4 — CID 19169360
1-(4-butoxyphenyl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]urea (PubChem CID 19169360) has the molecular formula C18H19ClN4O4 and a molecular weight of 390.83 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]urea.
| Compound Name | 1-(4-butoxyphenyl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 19169360 |
| Molecular Formula | C18H19ClN4O4 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]urea |
| SMILES | CCCCOc1ccc(NC(=O)NN=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H19ClN4O4/c1-2-3-10-27-15-7-5-14(6-8-15)21-18(24)22-20-12-13-4-9-16(19)17(11-13)23(25)26/h4-9,11-12H,2-3,10H2,1H3,(H2,21,22,24) |
| InChIKey | ZXBCEITZFWPCMR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|