C21H22N4O3 — CID 98296708
3-[(4S)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]propanamide (PubChem CID 98296708) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[(4S)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-[(4S)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 98296708 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-[(4S)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]propanamide |
| SMILES | CC1=NNC(=O)[C@H]1CCC(=O)N/N=C\c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H22N4O3/c1-15-19(21(27)25-23-15)10-11-20(26)24-22-13-17-8-5-9-18(12-17)28-14-16-6-3-2-4-7-16/h2-9,12-13,19H,10-11,14H2,1H3,(H,24,26)(H,25,27)/b22-13-/t19-/m0/s1 |
| InChIKey | MPVAOKBGUKGGHS-CVHFWEDTSA-N |
| XLogP | 2.62 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|