C14H15ClN4O2 — CID 98451807
N-[(Z)-(2-chlorophenyl)methylideneamino]-3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanamide (PubChem CID 98451807) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is N-[(Z)-(2-chlorophenyl)methylideneamino]-3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanamide.
| Compound Name | N-[(Z)-(2-chlorophenyl)methylideneamino]-3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 98451807 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-[(Z)-(2-chlorophenyl)methylideneamino]-3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanamide |
| SMILES | CC1=NNC(=O)[C@@H]1CCC(=O)N/N=C\c1ccccc1Cl |
| InChI | InChI=1S/C14H15ClN4O2/c1-9-11(14(21)19-17-9)6-7-13(20)18-16-8-10-4-2-3-5-12(10)15/h2-5,8,11H,6-7H2,1H3,(H,18,20)(H,19,21)/b16-8-/t11-/m1/s1 |
| InChIKey | UFOHUCOSKDUOLE-OUZNOSRWSA-N |
| XLogP | 1.69 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|