C19H20N4O4S2 — CID 18109114
N'-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoyl]-2-hydroxybenzohydrazide (PubChem CID 18109114) has the molecular formula C19H20N4O4S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is N'-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 18109114 |
| Molecular Formula | C19H20N4O4S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N'-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoyl]-2-hydroxybenzohydrazide |
| SMILES | Cc1sc2nc(CSC(C)C(=O)NNC(=O)c3ccccc3O)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C19H20N4O4S2/c1-9-10(2)29-19-15(9)18(27)20-14(21-19)8-28-11(3)16(25)22-23-17(26)12-6-4-5-7-13(12)24/h4-7,11,24H,8H2,1-3H3,(H,22,25)(H,23,26)(H,20,21,27) |
| InChIKey | BGNPEHPHZBXALN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|