C22H26N4O5S2 — CID 24536006
2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N'-[2-(2-ethoxyphenoxy)acetyl]propanehydrazide (PubChem CID 24536006) has the molecular formula C22H26N4O5S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N'-[2-(2-ethoxyphenoxy)acetyl]propanehydrazide.
| Compound Name | 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N'-[2-(2-ethoxyphenoxy)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 24536006 |
| Molecular Formula | C22H26N4O5S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N'-[2-(2-ethoxyphenoxy)acetyl]propanehydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)C(C)SCc1nc2sc(C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C22H26N4O5S2/c1-5-30-15-8-6-7-9-16(15)31-10-18(27)25-26-20(28)14(4)32-11-17-23-21(29)19-12(2)13(3)33-22(19)24-17/h6-9,14H,5,10-11H2,1-4H3,(H,25,27)(H,26,28)(H,23,24,29) |
| InChIKey | OKDARRPHZPSLCR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|