C20H22N4O3S2 — CID 46653030
N'-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoyl]-2-methylbenzohydrazide (PubChem CID 46653030) has the molecular formula C20H22N4O3S2 and a molecular weight of 430.56 g/mol. Its IUPAC name is N'-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoyl]-2-methylbenzohydrazide.
| Compound Name | N'-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoyl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 46653030 |
| Molecular Formula | C20H22N4O3S2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N'-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoyl]-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)C(C)SCc1nc2sc(C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C20H22N4O3S2/c1-10-7-5-6-8-14(10)18(26)24-23-17(25)13(4)28-9-15-21-19(27)16-11(2)12(3)29-20(16)22-15/h5-8,13H,9H2,1-4H3,(H,23,25)(H,24,26)(H,21,22,27) |
| InChIKey | NNPMSEDMHDNARF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|