C21H20N4O4S — CID 4808815
N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2-(6-methyl-1-benzofuran-3-yl)acetohydrazide (PubChem CID 4808815) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2-(6-methyl-1-benzofuran-3-yl)acetohydrazide.
| Compound Name | N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2-(6-methyl-1-benzofuran-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 4808815 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N'-[2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetyl]-2-(6-methyl-1-benzofuran-3-yl)acetohydrazide |
| SMILES | Cc1ccc2c(CC(=O)NNC(=O)Cc3nc4sc(C)c(C)c4c(=O)[nH]3)coc2c1 |
| InChI | InChI=1S/C21H20N4O4S/c1-10-4-5-14-13(9-29-15(14)6-10)7-17(26)24-25-18(27)8-16-22-20(28)19-11(2)12(3)30-21(19)23-16/h4-6,9H,7-8H2,1-3H3,(H,24,26)(H,25,27)(H,22,23,28) |
| InChIKey | WJSDXLKHTYBPQD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|